About [4,5-dimethyl-1,3-di(propan-2-yl)imidazol-1-ium-2-yl] thiocyanate
[4,5-dimethyl-1,3-di(propan-2-yl)imidazol-1-ium-2-yl] thiocyanate (PubChem CID 122228484) has the molecular formula C12H20N3S+
and a molecular weight of 238.38 g/mol. Its IUPAC name is [4,5-dimethyl-1,3-di(propan-2-yl)imidazol-1-ium-2-yl] thiocyanate.
Molecular Properties
| Compound Name | [4,5-dimethyl-1,3-di(propan-2-yl)imidazol-1-ium-2-yl] thiocyanate |
| PubChem CID | 122228484 |
| Molecular Formula | C12H20N3S+ |
| Molecular Weight | 238.38 g/mol |
| Exact Mass | 238.14 |
| IUPAC Name | [4,5-dimethyl-1,3-di(propan-2-yl)imidazol-1-ium-2-yl] thiocyanate |
| SMILES | Cc1c(C)[n+](C(C)C)c(SC#N)n1C(C)C |
| InChI | InChI=1S/C12H20N3S/c1-8(2)14-10(5)11(6)15(9(3)4)12(14)16-7-13/h8-9H,1-6H3/q+1 |
| InChIKey | ZLTTYCHUNZKAGX-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 32.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.38 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze [4,5-dimethyl-1,3-di(propan-2-yl)imidazol-1-ium-2-yl] thiocyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4,5-dimethyl-1,3-di(propan-2-yl)imidazol-1-ium-2-yl] thiocyanate?
The IUPAC name of [4,5-dimethyl-1,3-di(propan-2-yl)imidazol-1-ium-2-yl] thiocyanate (CID 122228484) is [4,5-dimethyl-1,3-di(propan-2-yl)imidazol-1-ium-2-yl] thiocyanate.
What is the SMILES notation for [4,5-dimethyl-1,3-di(propan-2-yl)imidazol-1-ium-2-yl] thiocyanate?
The canonical SMILES for [4,5-dimethyl-1,3-di(propan-2-yl)imidazol-1-ium-2-yl] thiocyanate is Cc1c(C)[n+](C(C)C)c(SC#N)n1C(C)C.
What is the InChIKey of [4,5-dimethyl-1,3-di(propan-2-yl)imidazol-1-ium-2-yl] thiocyanate?
The InChIKey is ZLTTYCHUNZKAGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N3S/c1-8(2)14-10(5)11(6)15(9(3)4)12(14)16-7-13/h8-9H,1-6H3/q+1.
What are the key properties of [4,5-dimethyl-1,3-di(propan-2-yl)imidazol-1-ium-2-yl] thiocyanate?
[4,5-dimethyl-1,3-di(propan-2-yl)imidazol-1-ium-2-yl] thiocyanate has a molecular weight of 238.38 g/mol, XLogP of 3.13, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4,5-dimethyl-1,3-di(propan-2-yl)imidazol-1-ium-2-yl] thiocyanate is sourced from PubChem (CID 122228484), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).