C10H14O2 — CID 122228707
(4aS,7aR)-7,7a-dimethyl-1,4,4a,5-tetrahydrocyclopenta[c]pyran-3-one (PubChem CID 122228707) has the molecular formula C10H14O2 and a molecular weight of 166.22 g/mol. Its IUPAC name is (4aS,7aR)-7,7a-dimethyl-1,4,4a,5-tetrahydrocyclopenta[c]pyran-3-one.
| Compound Name | (4aS,7aR)-7,7a-dimethyl-1,4,4a,5-tetrahydrocyclopenta[c]pyran-3-one |
|---|---|
| PubChem CID | 122228707 |
| Molecular Formula | C10H14O2 |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.10 |
| IUPAC Name | (4aS,7aR)-7,7a-dimethyl-1,4,4a,5-tetrahydrocyclopenta[c]pyran-3-one |
| SMILES | CC1=CC[C@H]2CC(=O)OC[C@@]12C |
| InChI | InChI=1S/C10H14O2/c1-7-3-4-8-5-9(11)12-6-10(7,8)2/h3,8H,4-6H2,1-2H3/t8-,10-/m0/s1 |
| InChIKey | GNOMLJDPWRVCFX-WPRPVWTQSA-N |
| XLogP | 1.91 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|