About [3,5-bis(2-aminoethyl)-1,3,5-triazinan-1-yl]methanol
[3,5-bis(2-aminoethyl)-1,3,5-triazinan-1-yl]methanol (PubChem CID 122229354) has the molecular formula C8H21N5O
and a molecular weight of 203.29 g/mol. Its IUPAC name is [3,5-bis(2-aminoethyl)-1,3,5-triazinan-1-yl]methanol.
Molecular Properties
| Compound Name | [3,5-bis(2-aminoethyl)-1,3,5-triazinan-1-yl]methanol |
| PubChem CID | 122229354 |
| Molecular Formula | C8H21N5O |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.17 |
| IUPAC Name | [3,5-bis(2-aminoethyl)-1,3,5-triazinan-1-yl]methanol |
| SMILES | NCCN1CN(CO)CN(CCN)C1 |
| InChI | InChI=1S/C8H21N5O/c9-1-3-11-5-12(4-2-10)7-13(6-11)8-14/h14H,1-10H2 |
| InChIKey | LWISSJGOMXALEM-UHFFFAOYSA-N |
| XLogP | -2.35 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | -2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [3,5-bis(2-aminoethyl)-1,3,5-triazinan-1-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3,5-bis(2-aminoethyl)-1,3,5-triazinan-1-yl]methanol?
The IUPAC name of [3,5-bis(2-aminoethyl)-1,3,5-triazinan-1-yl]methanol (CID 122229354) is [3,5-bis(2-aminoethyl)-1,3,5-triazinan-1-yl]methanol.
What is the SMILES notation for [3,5-bis(2-aminoethyl)-1,3,5-triazinan-1-yl]methanol?
The canonical SMILES for [3,5-bis(2-aminoethyl)-1,3,5-triazinan-1-yl]methanol is NCCN1CN(CO)CN(CCN)C1.
What is the InChIKey of [3,5-bis(2-aminoethyl)-1,3,5-triazinan-1-yl]methanol?
The InChIKey is LWISSJGOMXALEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H21N5O/c9-1-3-11-5-12(4-2-10)7-13(6-11)8-14/h14H,1-10H2.
What are the key properties of [3,5-bis(2-aminoethyl)-1,3,5-triazinan-1-yl]methanol?
[3,5-bis(2-aminoethyl)-1,3,5-triazinan-1-yl]methanol has a molecular weight of 203.29 g/mol, XLogP of -2.35, 5 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [3,5-bis(2-aminoethyl)-1,3,5-triazinan-1-yl]methanol is sourced from PubChem (CID 122229354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).