C14H13F9N2O — CID 122229615
ethyl N-[2-[[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]amino]phenyl]ethanimidate (PubChem CID 122229615) has the molecular formula C14H13F9N2O and a molecular weight of 396.25 g/mol. Its IUPAC name is ethyl N-[2-[[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]amino]phenyl]ethanimidate.
| Compound Name | ethyl N-[2-[[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]amino]phenyl]ethanimidate |
|---|---|
| PubChem CID | 122229615 |
| Molecular Formula | C14H13F9N2O |
| Molecular Weight | 396.25 g/mol |
| Exact Mass | 396.09 |
| IUPAC Name | ethyl N-[2-[[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]amino]phenyl]ethanimidate |
| SMILES | CCO/C(C)=N/c1ccccc1NC(C(F)(F)F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C14H13F9N2O/c1-3-26-8(2)24-9-6-4-5-7-10(9)25-11(12(15,16)17,13(18,19)20)14(21,22)23/h4-7,25H,3H2,1-2H3/b24-8+ |
| InChIKey | HHXCXFUFDFJRSO-KTZMUZOWSA-N |
| XLogP | 5.61 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.25 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|