C32H34N4O8 — CID 122229905
5,6,11,12,17,18,23,24-octamethoxy-25,26,27,28-tetrazapentacyclo[20.2.1.14,7.110,13.116,19]octacosa-1(25),2,4,6,8,10(27),11,13,15,17,19,21,23-tridecaene (PubChem CID 122229905) has the molecular formula C32H34N4O8 and a molecular weight of 602.64 g/mol. Its IUPAC name is 5,6,11,12,17,18,23,24-octamethoxy-25,26,27,28-tetrazapentacyclo[20.2.1.14,7.110,13.116,19]octacosa-1(25),2,4,6,8,10(27),11,13,15,17,19,21,23-tridecaene.
| Compound Name | 5,6,11,12,17,18,23,24-octamethoxy-25,26,27,28-tetrazapentacyclo[20.2.1.14,7.110,13.116,19]octacosa-1(25),2,4,6,8,10(27),11,13,15,17,19,21,23-tridecaene |
|---|---|
| PubChem CID | 122229905 |
| Molecular Formula | C32H34N4O8 |
| Molecular Weight | 602.64 g/mol |
| Exact Mass | 602.24 |
| IUPAC Name | 5,6,11,12,17,18,23,24-octamethoxy-25,26,27,28-tetrazapentacyclo[20.2.1.14,7.110,13.116,19]octacosa-1(25),2,4,6,8,10(27),11,13,15,17,19,21,23-tridecaene |
| SMILES | COC1=C(OC)c2ccc3[nH]c(ccc4nc(ccc5[nH]c(ccc1n2)c(OC)c5OC)C(OC)=C4OC)c(OC)c3OC |
| InChI | InChI=1S/C32H34N4O8/c1-37-25-17-9-10-19-27(39-3)29(41-5)21(34-19)13-14-23-31(43-7)32(44-8)24(36-23)16-15-22-30(42-6)28(40-4)20(35-22)12-11-18(33-17)26(25)38-2/h9-16,33,36H,1-8H3/b10-9-,12-11-,14-13-,16-15-,17-9-,18-11-,19-10+,20-12+,21-13+,22-15+,23-14+,24-16+ |
| InChIKey | VFXKSRVYXVEUCJ-XAJWITAYSA-N |
| XLogP | 5.71 |
| TPSA | 131.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.64 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |