About 1-[(3R)-hexa-1,5-dien-3-yl]-4-iodobenzene
1-[(3R)-hexa-1,5-dien-3-yl]-4-iodobenzene (PubChem CID 122229910) has the molecular formula C12H13I
and a molecular weight of 284.14 g/mol. Its IUPAC name is 1-[(3R)-hexa-1,5-dien-3-yl]-4-iodobenzene.
Molecular Properties
| Compound Name | 1-[(3R)-hexa-1,5-dien-3-yl]-4-iodobenzene |
| PubChem CID | 122229910 |
| Molecular Formula | C12H13I |
| Molecular Weight | 284.14 g/mol |
| Exact Mass | 284.01 |
| IUPAC Name | 1-[(3R)-hexa-1,5-dien-3-yl]-4-iodobenzene |
| SMILES | C=CC[C@H](C=C)c1ccc(I)cc1 |
| InChI | InChI=1S/C12H13I/c1-3-5-10(4-2)11-6-8-12(13)9-7-11/h3-4,6-10H,1-2,5H2/t10-/m0/s1 |
| InChIKey | SBCDLBQLNVGDMF-JTQLQIEISA-N |
| XLogP | 4.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.14 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(3R)-hexa-1,5-dien-3-yl]-4-iodobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3R)-hexa-1,5-dien-3-yl]-4-iodobenzene?
The IUPAC name of 1-[(3R)-hexa-1,5-dien-3-yl]-4-iodobenzene (CID 122229910) is 1-[(3R)-hexa-1,5-dien-3-yl]-4-iodobenzene.
What is the SMILES notation for 1-[(3R)-hexa-1,5-dien-3-yl]-4-iodobenzene?
The canonical SMILES for 1-[(3R)-hexa-1,5-dien-3-yl]-4-iodobenzene is C=CC[C@H](C=C)c1ccc(I)cc1.
What is the InChIKey of 1-[(3R)-hexa-1,5-dien-3-yl]-4-iodobenzene?
The InChIKey is SBCDLBQLNVGDMF-JTQLQIEISA-N. The full InChI is InChI=1S/C12H13I/c1-3-5-10(4-2)11-6-8-12(13)9-7-11/h3-4,6-10H,1-2,5H2/t10-/m0/s1.
What are the key properties of 1-[(3R)-hexa-1,5-dien-3-yl]-4-iodobenzene?
1-[(3R)-hexa-1,5-dien-3-yl]-4-iodobenzene has a molecular weight of 284.14 g/mol, XLogP of 4.14, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3R)-hexa-1,5-dien-3-yl]-4-iodobenzene is sourced from PubChem (CID 122229910), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).