C17H29NO3 — CID 122230004
(3R,4S,5S,7R,9Z,11R,12R)-12-ethyl-4-hydroxy-3,5,7,11-tetramethyl-1-azacyclododec-9-ene-2,8-dione (PubChem CID 122230004) has the molecular formula C17H29NO3 and a molecular weight of 295.42 g/mol. Its IUPAC name is (3R,4S,5S,7R,9Z,11R,12R)-12-ethyl-4-hydroxy-3,5,7,11-tetramethyl-1-azacyclododec-9-ene-2,8-dione.
| Compound Name | (3R,4S,5S,7R,9Z,11R,12R)-12-ethyl-4-hydroxy-3,5,7,11-tetramethyl-1-azacyclododec-9-ene-2,8-dione |
|---|---|
| PubChem CID | 122230004 |
| Molecular Formula | C17H29NO3 |
| Molecular Weight | 295.42 g/mol |
| Exact Mass | 295.21 |
| IUPAC Name | (3R,4S,5S,7R,9Z,11R,12R)-12-ethyl-4-hydroxy-3,5,7,11-tetramethyl-1-azacyclododec-9-ene-2,8-dione |
| SMILES | CC[C@H]1NC(=O)[C@H](C)[C@@H](O)[C@@H](C)C[C@@H](C)C(=O)/C=C\[C@H]1C |
| InChI | InChI=1S/C17H29NO3/c1-6-14-10(2)7-8-15(19)11(3)9-12(4)16(20)13(5)17(21)18-14/h7-8,10-14,16,20H,6,9H2,1-5H3,(H,18,21)/b8-7-/t10-,11-,12+,13-,14-,16+/m1/s1 |
| InChIKey | BCQMGQGLGBKROB-JEBZXFOISA-N |
| XLogP | 2.32 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.42 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |