About methyl N-(3,4-dimethylphenyl)-N-(methoxycarbonylamino)carbamate
methyl N-(3,4-dimethylphenyl)-N-(methoxycarbonylamino)carbamate (PubChem CID 122230063) has the molecular formula C12H16N2O4
and a molecular weight of 252.27 g/mol. Its IUPAC name is methyl N-(3,4-dimethylphenyl)-N-(methoxycarbonylamino)carbamate.
Molecular Properties
| Compound Name | methyl N-(3,4-dimethylphenyl)-N-(methoxycarbonylamino)carbamate |
| PubChem CID | 122230063 |
| Molecular Formula | C12H16N2O4 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | methyl N-(3,4-dimethylphenyl)-N-(methoxycarbonylamino)carbamate |
| SMILES | COC(=O)NN(C(=O)OC)c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C12H16N2O4/c1-8-5-6-10(7-9(8)2)14(12(16)18-4)13-11(15)17-3/h5-7H,1-4H3,(H,13,15) |
| InChIKey | BLVSSGFQAVYTLO-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl N-(3,4-dimethylphenyl)-N-(methoxycarbonylamino)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-(3,4-dimethylphenyl)-N-(methoxycarbonylamino)carbamate?
The IUPAC name of methyl N-(3,4-dimethylphenyl)-N-(methoxycarbonylamino)carbamate (CID 122230063) is methyl N-(3,4-dimethylphenyl)-N-(methoxycarbonylamino)carbamate.
What is the SMILES notation for methyl N-(3,4-dimethylphenyl)-N-(methoxycarbonylamino)carbamate?
The canonical SMILES for methyl N-(3,4-dimethylphenyl)-N-(methoxycarbonylamino)carbamate is COC(=O)NN(C(=O)OC)c1ccc(C)c(C)c1.
What is the InChIKey of methyl N-(3,4-dimethylphenyl)-N-(methoxycarbonylamino)carbamate?
The InChIKey is BLVSSGFQAVYTLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2O4/c1-8-5-6-10(7-9(8)2)14(12(16)18-4)13-11(15)17-3/h5-7H,1-4H3,(H,13,15).
What are the key properties of methyl N-(3,4-dimethylphenyl)-N-(methoxycarbonylamino)carbamate?
methyl N-(3,4-dimethylphenyl)-N-(methoxycarbonylamino)carbamate has a molecular weight of 252.27 g/mol, XLogP of 2.15, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-(3,4-dimethylphenyl)-N-(methoxycarbonylamino)carbamate is sourced from PubChem (CID 122230063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).