C23H29NO2 — CID 122230426
3-[(1R)-1-(4-methoxyanilino)-1-phenylbutyl]cyclohexan-1-one (PubChem CID 122230426) has the molecular formula C23H29NO2 and a molecular weight of 351.49 g/mol. Its IUPAC name is 3-[(1R)-1-(4-methoxyanilino)-1-phenylbutyl]cyclohexan-1-one.
| Compound Name | 3-[(1R)-1-(4-methoxyanilino)-1-phenylbutyl]cyclohexan-1-one |
|---|---|
| PubChem CID | 122230426 |
| Molecular Formula | C23H29NO2 |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.22 |
| IUPAC Name | 3-[(1R)-1-(4-methoxyanilino)-1-phenylbutyl]cyclohexan-1-one |
| SMILES | CCC[C@](Nc1ccc(OC)cc1)(c1ccccc1)C1CCCC(=O)C1 |
| InChI | InChI=1S/C23H29NO2/c1-3-16-23(18-8-5-4-6-9-18,19-10-7-11-21(25)17-19)24-20-12-14-22(26-2)15-13-20/h4-6,8-9,12-15,19,24H,3,7,10-11,16-17H2,1-2H3/t19?,23-/m0/s1 |
| InChIKey | CWTKYRWNOSXLIQ-BVHINDKJSA-N |
| XLogP | 5.56 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|