C22H4F10N2O — CID 122230710
(Z)-3-[5-[(Z)-2-cyano-2-(2,3,4,5,6-pentafluorophenyl)ethenyl]furan-2-yl]-2-(2,3,4,5,6-pentafluorophenyl)prop-2-enenitrile (PubChem CID 122230710) has the molecular formula C22H4F10N2O and a molecular weight of 502.27 g/mol. Its IUPAC name is (Z)-3-[5-[(Z)-2-cyano-2-(2,3,4,5,6-pentafluorophenyl)ethenyl]furan-2-yl]-2-(2,3,4,5,6-pentafluorophenyl)prop-2-enenitrile.
| Compound Name | (Z)-3-[5-[(Z)-2-cyano-2-(2,3,4,5,6-pentafluorophenyl)ethenyl]furan-2-yl]-2-(2,3,4,5,6-pentafluorophenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 122230710 |
| Molecular Formula | C22H4F10N2O |
| Molecular Weight | 502.27 g/mol |
| Exact Mass | 502.02 |
| IUPAC Name | (Z)-3-[5-[(Z)-2-cyano-2-(2,3,4,5,6-pentafluorophenyl)ethenyl]furan-2-yl]-2-(2,3,4,5,6-pentafluorophenyl)prop-2-enenitrile |
| SMILES | N#C/C(=C\c1ccc(/C=C(\C#N)c2c(F)c(F)c(F)c(F)c2F)o1)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C22H4F10N2O/c23-13-11(14(24)18(28)21(31)17(13)27)7(5-33)3-9-1-2-10(35-9)4-8(6-34)12-15(25)19(29)22(32)20(30)16(12)26/h1-4H/b7-3+,8-4+ |
| InChIKey | NNFHMZLBFWXNIQ-FCXRPNKRSA-N |
| XLogP | 6.80 |
| TPSA | 60.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.27 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|