C27H32O3 — CID 122230863
cyclohexyl-[(2R,3S)-2,3-dihydroxy-5-methylidene-2,3-bis(4-methylphenyl)cyclopentyl]methanone (PubChem CID 122230863) has the molecular formula C27H32O3 and a molecular weight of 404.55 g/mol. Its IUPAC name is cyclohexyl-[(2R,3S)-2,3-dihydroxy-5-methylidene-2,3-bis(4-methylphenyl)cyclopentyl]methanone.
| Compound Name | cyclohexyl-[(2R,3S)-2,3-dihydroxy-5-methylidene-2,3-bis(4-methylphenyl)cyclopentyl]methanone |
|---|---|
| PubChem CID | 122230863 |
| Molecular Formula | C27H32O3 |
| Molecular Weight | 404.55 g/mol |
| Exact Mass | 404.24 |
| IUPAC Name | cyclohexyl-[(2R,3S)-2,3-dihydroxy-5-methylidene-2,3-bis(4-methylphenyl)cyclopentyl]methanone |
| SMILES | C=C1C[C@](O)(c2ccc(C)cc2)[C@](O)(c2ccc(C)cc2)C1C(=O)C1CCCCC1 |
| InChI | InChI=1S/C27H32O3/c1-18-9-13-22(14-10-18)26(29)17-20(3)24(25(28)21-7-5-4-6-8-21)27(26,30)23-15-11-19(2)12-16-23/h9-16,21,24,29-30H,3-8,17H2,1-2H3/t24?,26-,27-/m0/s1 |
| InChIKey | ROJZOUKPFOSCPZ-AXJMSPCVSA-N |
| XLogP | 5.10 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.55 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|