C20H20O3 — CID 122230864
[(2R,3R)-2,3-dihydroxy-3-methyl-5-methylidene-2-phenylcyclopentyl]-phenylmethanone (PubChem CID 122230864) has the molecular formula C20H20O3 and a molecular weight of 308.38 g/mol. Its IUPAC name is [(2R,3R)-2,3-dihydroxy-3-methyl-5-methylidene-2-phenylcyclopentyl]-phenylmethanone.
| Compound Name | [(2R,3R)-2,3-dihydroxy-3-methyl-5-methylidene-2-phenylcyclopentyl]-phenylmethanone |
|---|---|
| PubChem CID | 122230864 |
| Molecular Formula | C20H20O3 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | [(2R,3R)-2,3-dihydroxy-3-methyl-5-methylidene-2-phenylcyclopentyl]-phenylmethanone |
| SMILES | C=C1C[C@@](C)(O)[C@](O)(c2ccccc2)C1C(=O)c1ccccc1 |
| InChI | InChI=1S/C20H20O3/c1-14-13-19(2,22)20(23,16-11-7-4-8-12-16)17(14)18(21)15-9-5-3-6-10-15/h3-12,17,22-23H,1,13H2,2H3/t17?,19-,20+/m1/s1 |
| InChIKey | PPJNMMRVQASYQB-GQXIWKRZSA-N |
| XLogP | 3.08 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|