C23H47BO2Si4 — CID 122230895
trimethyl-[[2-phenyl-2-(4,4,6-trimethyl-1,3,2-dioxaborinan-2-yl)ethyl]-bis(trimethylsilyl)silyl]silane (PubChem CID 122230895) has the molecular formula C23H47BO2Si4 and a molecular weight of 478.78 g/mol. Its IUPAC name is trimethyl-[[2-phenyl-2-(4,4,6-trimethyl-1,3,2-dioxaborinan-2-yl)ethyl]-bis(trimethylsilyl)silyl]silane.
| Compound Name | trimethyl-[[2-phenyl-2-(4,4,6-trimethyl-1,3,2-dioxaborinan-2-yl)ethyl]-bis(trimethylsilyl)silyl]silane |
|---|---|
| PubChem CID | 122230895 |
| Molecular Formula | C23H47BO2Si4 |
| Molecular Weight | 478.78 g/mol |
| Exact Mass | 478.27 |
| IUPAC Name | trimethyl-[[2-phenyl-2-(4,4,6-trimethyl-1,3,2-dioxaborinan-2-yl)ethyl]-bis(trimethylsilyl)silyl]silane |
| SMILES | CC1CC(C)(C)OB(C(C[Si]([Si](C)(C)C)([Si](C)(C)C)[Si](C)(C)C)c2ccccc2)O1 |
| InChI | InChI=1S/C23H47BO2Si4/c1-20-18-23(2,3)26-24(25-20)22(21-16-14-13-15-17-21)19-30(27(4,5)6,28(7,8)9)29(10,11)12/h13-17,20,22H,18-19H2,1-12H3 |
| InChIKey | UECCZAOROIZORW-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.78 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|