C23H29N3O — CID 122231208
1-butyl-1'-pentylspiro[2H-pyrrolo[2,3-b]pyridine-3,3'-indole]-2'-one (PubChem CID 122231208) has the molecular formula C23H29N3O and a molecular weight of 363.51 g/mol. Its IUPAC name is 1-butyl-1'-pentylspiro[2H-pyrrolo[2,3-b]pyridine-3,3'-indole]-2'-one.
| Compound Name | 1-butyl-1'-pentylspiro[2H-pyrrolo[2,3-b]pyridine-3,3'-indole]-2'-one |
|---|---|
| PubChem CID | 122231208 |
| Molecular Formula | C23H29N3O |
| Molecular Weight | 363.51 g/mol |
| Exact Mass | 363.23 |
| IUPAC Name | 1-butyl-1'-pentylspiro[2H-pyrrolo[2,3-b]pyridine-3,3'-indole]-2'-one |
| SMILES | CCCCCN1C(=O)C2(CN(CCCC)c3ncccc32)c2ccccc21 |
| InChI | InChI=1S/C23H29N3O/c1-3-5-9-16-26-20-13-8-7-11-18(20)23(22(26)27)17-25(15-6-4-2)21-19(23)12-10-14-24-21/h7-8,10-14H,3-6,9,15-17H2,1-2H3 |
| InChIKey | HVAJOMFKKRJGQI-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.51 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|