About 1-butyl-1'-pentylspiro[2H-pyrrolo[2,3-b]pyridine-3,3'-indole]-2'-one
1-butyl-1'-pentylspiro[2H-pyrrolo[2,3-b]pyridine-3,3'-indole]-2'-one (PubChem CID 122231208) has the molecular formula C23H29N3O
and a molecular weight of 363.51 g/mol. Its IUPAC name is 1-butyl-1'-pentylspiro[2H-pyrrolo[2,3-b]pyridine-3,3'-indole]-2'-one.
Molecular Properties
| Compound Name | 1-butyl-1'-pentylspiro[2H-pyrrolo[2,3-b]pyridine-3,3'-indole]-2'-one |
| PubChem CID | 122231208 |
| Molecular Formula | C23H29N3O |
| Molecular Weight | 363.51 g/mol |
| Exact Mass | 363.23 |
| IUPAC Name | 1-butyl-1'-pentylspiro[2H-pyrrolo[2,3-b]pyridine-3,3'-indole]-2'-one |
| SMILES | CCCCCN1C(=O)C2(CN(CCCC)c3ncccc32)c2ccccc21 |
| InChI | InChI=1S/C23H29N3O/c1-3-5-9-16-26-20-13-8-7-11-18(20)23(22(26)27)17-25(15-6-4-2)21-19(23)12-10-14-24-21/h7-8,10-14H,3-6,9,15-17H2,1-2H3 |
| InChIKey | HVAJOMFKKRJGQI-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.51 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-butyl-1'-pentylspiro[2H-pyrrolo[2,3-b]pyridine-3,3'-indole]-2'-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-1'-pentylspiro[2H-pyrrolo[2,3-b]pyridine-3,3'-indole]-2'-one?
The IUPAC name of 1-butyl-1'-pentylspiro[2H-pyrrolo[2,3-b]pyridine-3,3'-indole]-2'-one (CID 122231208) is 1-butyl-1'-pentylspiro[2H-pyrrolo[2,3-b]pyridine-3,3'-indole]-2'-one.
What is the SMILES notation for 1-butyl-1'-pentylspiro[2H-pyrrolo[2,3-b]pyridine-3,3'-indole]-2'-one?
The canonical SMILES for 1-butyl-1'-pentylspiro[2H-pyrrolo[2,3-b]pyridine-3,3'-indole]-2'-one is CCCCCN1C(=O)C2(CN(CCCC)c3ncccc32)c2ccccc21.
What is the InChIKey of 1-butyl-1'-pentylspiro[2H-pyrrolo[2,3-b]pyridine-3,3'-indole]-2'-one?
The InChIKey is HVAJOMFKKRJGQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H29N3O/c1-3-5-9-16-26-20-13-8-7-11-18(20)23(22(26)27)17-25(15-6-4-2)21-19(23)12-10-14-24-21/h7-8,10-14H,3-6,9,15-17H2,1-2H3.
What are the key properties of 1-butyl-1'-pentylspiro[2H-pyrrolo[2,3-b]pyridine-3,3'-indole]-2'-one?
1-butyl-1'-pentylspiro[2H-pyrrolo[2,3-b]pyridine-3,3'-indole]-2'-one has a molecular weight of 363.51 g/mol, XLogP of 4.52, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-1'-pentylspiro[2H-pyrrolo[2,3-b]pyridine-3,3'-indole]-2'-one is sourced from PubChem (CID 122231208), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).