C23H41N7 — CID 122232053
1,3-bis[4,5-dimethyl-1,3-di(propan-2-yl)imidazol-2-ylidene]guanidine (PubChem CID 122232053) has the molecular formula C23H41N7 and a molecular weight of 415.63 g/mol. Its IUPAC name is 1,3-bis[4,5-dimethyl-1,3-di(propan-2-yl)imidazol-2-ylidene]guanidine.
| Compound Name | 1,3-bis[4,5-dimethyl-1,3-di(propan-2-yl)imidazol-2-ylidene]guanidine |
|---|---|
| PubChem CID | 122232053 |
| Molecular Formula | C23H41N7 |
| Molecular Weight | 415.63 g/mol |
| Exact Mass | 415.34 |
| IUPAC Name | 1,3-bis[4,5-dimethyl-1,3-di(propan-2-yl)imidazol-2-ylidene]guanidine |
| SMILES | [H]N=C(N=c1n(C(C)C)c(C)c(C)n1C(C)C)N=c1n(C(C)C)c(C)c(C)n1C(C)C |
| InChI | InChI=1S/C23H41N7/c1-13(2)27-17(9)18(10)28(14(3)4)22(27)25-21(24)26-23-29(15(5)6)19(11)20(12)30(23)16(7)8/h13-16,24H,1-12H3 |
| InChIKey | JDOBENZNVWYFOK-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.63 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|