C26H47N7 — CID 122232055
1,3-bis[4,5-dimethyl-1,3-di(propan-2-yl)imidazol-2-ylidene]-2-propan-2-ylguanidine (PubChem CID 122232055) has the molecular formula C26H47N7 and a molecular weight of 457.71 g/mol. Its IUPAC name is 1,3-bis[4,5-dimethyl-1,3-di(propan-2-yl)imidazol-2-ylidene]-2-propan-2-ylguanidine.
| Compound Name | 1,3-bis[4,5-dimethyl-1,3-di(propan-2-yl)imidazol-2-ylidene]-2-propan-2-ylguanidine |
|---|---|
| PubChem CID | 122232055 |
| Molecular Formula | C26H47N7 |
| Molecular Weight | 457.71 g/mol |
| Exact Mass | 457.39 |
| IUPAC Name | 1,3-bis[4,5-dimethyl-1,3-di(propan-2-yl)imidazol-2-ylidene]-2-propan-2-ylguanidine |
| SMILES | Cc1c(C)n(C(C)C)c(=NC(=NC(C)C)N=c2n(C(C)C)c(C)c(C)n2C(C)C)n1C(C)C |
| InChI | InChI=1S/C26H47N7/c1-15(2)27-24(28-25-30(16(3)4)20(11)21(12)31(25)17(5)6)29-26-32(18(7)8)22(13)23(14)33(26)19(9)10/h15-19H,1-14H3 |
| InChIKey | NXAAAVZUGIRTJP-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 56.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.71 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|