C28H51N7 — CID 122232057
1,3-bis[4,5-dimethyl-1,3-di(propan-2-yl)imidazol-2-ylidene]-2-(2,2-dimethylpropyl)guanidine (PubChem CID 122232057) has the molecular formula C28H51N7 and a molecular weight of 485.77 g/mol. Its IUPAC name is 1,3-bis[4,5-dimethyl-1,3-di(propan-2-yl)imidazol-2-ylidene]-2-(2,2-dimethylpropyl)guanidine.
| Compound Name | 1,3-bis[4,5-dimethyl-1,3-di(propan-2-yl)imidazol-2-ylidene]-2-(2,2-dimethylpropyl)guanidine |
|---|---|
| PubChem CID | 122232057 |
| Molecular Formula | C28H51N7 |
| Molecular Weight | 485.77 g/mol |
| Exact Mass | 485.42 |
| IUPAC Name | 1,3-bis[4,5-dimethyl-1,3-di(propan-2-yl)imidazol-2-ylidene]-2-(2,2-dimethylpropyl)guanidine |
| SMILES | Cc1c(C)n(C(C)C)c(=NC(=NCC(C)(C)C)N=c2n(C(C)C)c(C)c(C)n2C(C)C)n1C(C)C |
| InChI | InChI=1S/C28H51N7/c1-17(2)32-21(9)22(10)33(18(3)4)26(32)30-25(29-16-28(13,14)15)31-27-34(19(5)6)23(11)24(12)35(27)20(7)8/h17-20H,16H2,1-15H3 |
| InChIKey | GXJFUEDGMKPIRP-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 56.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.77 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|