C24H43N7 — CID 122232058
1,3-bis[4,5-dimethyl-1,3-di(propan-2-yl)imidazol-2-ylidene]-2-methylguanidine (PubChem CID 122232058) has the molecular formula C24H43N7 and a molecular weight of 429.66 g/mol. Its IUPAC name is 1,3-bis[4,5-dimethyl-1,3-di(propan-2-yl)imidazol-2-ylidene]-2-methylguanidine.
| Compound Name | 1,3-bis[4,5-dimethyl-1,3-di(propan-2-yl)imidazol-2-ylidene]-2-methylguanidine |
|---|---|
| PubChem CID | 122232058 |
| Molecular Formula | C24H43N7 |
| Molecular Weight | 429.66 g/mol |
| Exact Mass | 429.36 |
| IUPAC Name | 1,3-bis[4,5-dimethyl-1,3-di(propan-2-yl)imidazol-2-ylidene]-2-methylguanidine |
| SMILES | CN=C(N=c1n(C(C)C)c(C)c(C)n1C(C)C)N=c1n(C(C)C)c(C)c(C)n1C(C)C |
| InChI | InChI=1S/C24H43N7/c1-14(2)28-18(9)19(10)29(15(3)4)23(28)26-22(25-13)27-24-30(16(5)6)20(11)21(12)31(24)17(7)8/h14-17H,1-13H3 |
| InChIKey | IYXCZJZDWLMJBF-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 56.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.66 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|