About CID 122232078
CID 122232078 (PubChem CID 122232078) has the molecular formula C6H21BNSi2
and a molecular weight of 174.22 g/mol.
Molecular Properties
| Compound Name | CID 122232078 |
| PubChem CID | 122232078 |
| Molecular Formula | C6H21BNSi2 |
| Molecular Weight | 174.22 g/mol |
| Exact Mass | 174.13 |
| IUPAC Name | — |
| SMILES | [BH3-][N+]([Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C6H21BNSi2/c1-9(2,3)8(7)10(4,5)6/h1-7H3 |
| InChIKey | YKBRUNWAFIUXJA-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 5.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.22 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 122232078 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 122232078?
The IUPAC name of CID 122232078 (CID 122232078) is not available.
What is the SMILES notation for CID 122232078?
The canonical SMILES for CID 122232078 is [BH3-][N+]([Si](C)(C)C)[Si](C)(C)C.
What is the InChIKey of CID 122232078?
The InChIKey is YKBRUNWAFIUXJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H21BNSi2/c1-9(2,3)8(7)10(4,5)6/h1-7H3.
What are the key properties of CID 122232078?
CID 122232078 has a molecular weight of 174.22 g/mol, XLogP of 1.08, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 122232078 is sourced from PubChem (CID 122232078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).