C6H9N7O8 — CID 122232363
[5-(hydroxymethyl)-4-(2,2,2-trinitroethylamino)-1,2,4-triazol-3-yl]methanol (PubChem CID 122232363) has the molecular formula C6H9N7O8 and a molecular weight of 307.18 g/mol. Its IUPAC name is [5-(hydroxymethyl)-4-(2,2,2-trinitroethylamino)-1,2,4-triazol-3-yl]methanol.
| Compound Name | [5-(hydroxymethyl)-4-(2,2,2-trinitroethylamino)-1,2,4-triazol-3-yl]methanol |
|---|---|
| PubChem CID | 122232363 |
| Molecular Formula | C6H9N7O8 |
| Molecular Weight | 307.18 g/mol |
| Exact Mass | 307.05 |
| IUPAC Name | [5-(hydroxymethyl)-4-(2,2,2-trinitroethylamino)-1,2,4-triazol-3-yl]methanol |
| SMILES | O=[N+]([O-])C(CNn1c(CO)nnc1CO)([N+](=O)[O-])[N+](=O)[O-] |
| InChI | InChI=1S/C6H9N7O8/c14-1-4-8-9-5(2-15)10(4)7-3-6(11(16)17,12(18)19)13(20)21/h7,14-15H,1-3H2 |
| InChIKey | PTNSNCHKIWVCEY-UHFFFAOYSA-N |
| XLogP | -2.71 |
| TPSA | 212.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.18 |
| LogP ≤ 5 | -2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|