C20H28NP — CID 122232365
ditert-butyl-[(6-phenyl-2-pyridinyl)methyl]phosphane (PubChem CID 122232365) has the molecular formula C20H28NP and a molecular weight of 313.43 g/mol. Its IUPAC name is ditert-butyl-[(6-phenyl-2-pyridinyl)methyl]phosphane.
| Compound Name | ditert-butyl-[(6-phenyl-2-pyridinyl)methyl]phosphane |
|---|---|
| PubChem CID | 122232365 |
| Molecular Formula | C20H28NP |
| Molecular Weight | 313.43 g/mol |
| Exact Mass | 313.20 |
| IUPAC Name | ditert-butyl-[(6-phenyl-2-pyridinyl)methyl]phosphane |
| SMILES | CC(C)(C)P(Cc1cccc(-c2ccccc2)n1)C(C)(C)C |
| InChI | InChI=1S/C20H28NP/c1-19(2,3)22(20(4,5)6)15-17-13-10-14-18(21-17)16-11-8-7-9-12-16/h7-14H,15H2,1-6H3 |
| InChIKey | CIBFCFLXSFROSZ-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.43 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|