C9H8F6OS — CID 122232662
(1S,4R)-3,3-bis(trifluoromethyl)-2λ4-thiabicyclo[2.2.2]oct-5-ene 2-oxide (PubChem CID 122232662) has the molecular formula C9H8F6OS and a molecular weight of 278.22 g/mol. Its IUPAC name is (1S,4R)-3,3-bis(trifluoromethyl)-2λ4-thiabicyclo[2.2.2]oct-5-ene 2-oxide.
| Compound Name | (1S,4R)-3,3-bis(trifluoromethyl)-2λ4-thiabicyclo[2.2.2]oct-5-ene 2-oxide |
|---|---|
| PubChem CID | 122232662 |
| Molecular Formula | C9H8F6OS |
| Molecular Weight | 278.22 g/mol |
| Exact Mass | 278.02 |
| IUPAC Name | (1S,4R)-3,3-bis(trifluoromethyl)-2λ4-thiabicyclo[2.2.2]oct-5-ene 2-oxide |
| SMILES | O=S1[C@@H]2C=C[C@@H](CC2)C1(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H8F6OS/c10-8(11,12)7(9(13,14)15)5-1-3-6(4-2-5)17(7)16/h1,3,5-6H,2,4H2/t5-,6+,17?/m0/s1 |
| InChIKey | RPMZFBIIHGAWPM-YGFFCSEESA-N |
| XLogP | 2.95 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.22 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|