C19H14F4O3S — CID 122232695
3-(benzenesulfonyl)-2,2,3,3-tetrafluoro-1-naphthalen-1-ylpropan-1-ol (PubChem CID 122232695) has the molecular formula C19H14F4O3S and a molecular weight of 398.38 g/mol. Its IUPAC name is 3-(benzenesulfonyl)-2,2,3,3-tetrafluoro-1-naphthalen-1-ylpropan-1-ol.
| Compound Name | 3-(benzenesulfonyl)-2,2,3,3-tetrafluoro-1-naphthalen-1-ylpropan-1-ol |
|---|---|
| PubChem CID | 122232695 |
| Molecular Formula | C19H14F4O3S |
| Molecular Weight | 398.38 g/mol |
| Exact Mass | 398.06 |
| IUPAC Name | 3-(benzenesulfonyl)-2,2,3,3-tetrafluoro-1-naphthalen-1-ylpropan-1-ol |
| SMILES | O=S(=O)(c1ccccc1)C(F)(F)C(F)(F)C(O)c1cccc2ccccc12 |
| InChI | InChI=1S/C19H14F4O3S/c20-18(21,19(22,23)27(25,26)14-9-2-1-3-10-14)17(24)16-12-6-8-13-7-4-5-11-15(13)16/h1-12,17,24H |
| InChIKey | ZZNVSPSEVLROGW-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.38 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|