C15H12F4O3S — CID 122232698
3-(benzenesulfonyl)-2,2,3,3-tetrafluoro-1-phenylpropan-1-ol (PubChem CID 122232698) has the molecular formula C15H12F4O3S and a molecular weight of 348.32 g/mol. Its IUPAC name is 3-(benzenesulfonyl)-2,2,3,3-tetrafluoro-1-phenylpropan-1-ol.
| Compound Name | 3-(benzenesulfonyl)-2,2,3,3-tetrafluoro-1-phenylpropan-1-ol |
|---|---|
| PubChem CID | 122232698 |
| Molecular Formula | C15H12F4O3S |
| Molecular Weight | 348.32 g/mol |
| Exact Mass | 348.04 |
| IUPAC Name | 3-(benzenesulfonyl)-2,2,3,3-tetrafluoro-1-phenylpropan-1-ol |
| SMILES | O=S(=O)(c1ccccc1)C(F)(F)C(F)(F)C(O)c1ccccc1 |
| InChI | InChI=1S/C15H12F4O3S/c16-14(17,13(20)11-7-3-1-4-8-11)15(18,19)23(21,22)12-9-5-2-6-10-12/h1-10,13,20H |
| InChIKey | PABDPGVUAPEKHU-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.32 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|