C23H20FNO — CID 122232914
(3S,4R)-1-benzyl-3-fluoro-3-(2-methylphenyl)-4-phenylazetidin-2-one (PubChem CID 122232914) has the molecular formula C23H20FNO and a molecular weight of 345.42 g/mol. Its IUPAC name is (3S,4R)-1-benzyl-3-fluoro-3-(2-methylphenyl)-4-phenylazetidin-2-one.
| Compound Name | (3S,4R)-1-benzyl-3-fluoro-3-(2-methylphenyl)-4-phenylazetidin-2-one |
|---|---|
| PubChem CID | 122232914 |
| Molecular Formula | C23H20FNO |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | (3S,4R)-1-benzyl-3-fluoro-3-(2-methylphenyl)-4-phenylazetidin-2-one |
| SMILES | Cc1ccccc1[C@@]1(F)C(=O)N(Cc2ccccc2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C23H20FNO/c1-17-10-8-9-15-20(17)23(24)21(19-13-6-3-7-14-19)25(22(23)26)16-18-11-4-2-5-12-18/h2-15,21H,16H2,1H3/t21-,23+/m1/s1 |
| InChIKey | QVJOBDKCLTUOHU-GGAORHGYSA-N |
| XLogP | 4.94 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |