About 6-azido-2,6-dimethylhept-2-ene
6-azido-2,6-dimethylhept-2-ene (PubChem CID 122233674) has the molecular formula C9H17N3
and a molecular weight of 167.26 g/mol. Its IUPAC name is 6-azido-2,6-dimethylhept-2-ene.
Molecular Properties
| Compound Name | 6-azido-2,6-dimethylhept-2-ene |
| PubChem CID | 122233674 |
| Molecular Formula | C9H17N3 |
| Molecular Weight | 167.26 g/mol |
| Exact Mass | 167.14 |
| IUPAC Name | 6-azido-2,6-dimethylhept-2-ene |
| SMILES | CC(C)=CCCC(C)(C)N=[N+]=[N-] |
| InChI | InChI=1S/C9H17N3/c1-8(2)6-5-7-9(3,4)11-12-10/h6H,5,7H2,1-4H3 |
| InChIKey | IPPWZDIWCSENQM-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.26 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 6-azido-2,6-dimethylhept-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-azido-2,6-dimethylhept-2-ene?
The IUPAC name of 6-azido-2,6-dimethylhept-2-ene (CID 122233674) is 6-azido-2,6-dimethylhept-2-ene.
What is the SMILES notation for 6-azido-2,6-dimethylhept-2-ene?
The canonical SMILES for 6-azido-2,6-dimethylhept-2-ene is CC(C)=CCCC(C)(C)N=[N+]=[N-].
What is the InChIKey of 6-azido-2,6-dimethylhept-2-ene?
The InChIKey is IPPWZDIWCSENQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N3/c1-8(2)6-5-7-9(3,4)11-12-10/h6H,5,7H2,1-4H3.
What are the key properties of 6-azido-2,6-dimethylhept-2-ene?
6-azido-2,6-dimethylhept-2-ene has a molecular weight of 167.26 g/mol, XLogP of 3.82, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-azido-2,6-dimethylhept-2-ene is sourced from PubChem (CID 122233674), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).