About CID 122233784
CID 122233784 (PubChem CID 122233784) has the molecular formula C14H26NO3
and a molecular weight of 256.37 g/mol.
Molecular Properties
| Compound Name | CID 122233784 |
| PubChem CID | 122233784 |
| Molecular Formula | C14H26NO3 |
| Molecular Weight | 256.37 g/mol |
| Exact Mass | 256.19 |
| IUPAC Name | — |
| SMILES | CCCCC(=O)OC1CC(C)(C)N([O])C(C)(C)C1 |
| InChI | InChI=1S/C14H26NO3/c1-6-7-8-12(16)18-11-9-13(2,3)15(17)14(4,5)10-11/h11H,6-10H2,1-5H3 |
| InChIKey | XRLBBKINHYEUCN-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 49.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.37 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze CID 122233784 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 122233784?
The IUPAC name of CID 122233784 (CID 122233784) is not available.
What is the SMILES notation for CID 122233784?
The canonical SMILES for CID 122233784 is CCCCC(=O)OC1CC(C)(C)N([O])C(C)(C)C1.
What is the InChIKey of CID 122233784?
The InChIKey is XRLBBKINHYEUCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26NO3/c1-6-7-8-12(16)18-11-9-13(2,3)15(17)14(4,5)10-11/h11H,6-10H2,1-5H3.
What are the key properties of CID 122233784?
CID 122233784 has a molecular weight of 256.37 g/mol, XLogP of 3.09, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 122233784 is sourced from PubChem (CID 122233784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).