C32H56O5Si — CID 122233932
dimethyl 2-[(2E,6E)-8-[tert-butyl(dimethyl)silyl]oxy-3,7-dimethylundeca-2,6,10-trienyl]-2-[(E)-4,5-dimethylhex-3-enyl]propanedioate (PubChem CID 122233932) has the molecular formula C32H56O5Si and a molecular weight of 548.88 g/mol. Its IUPAC name is dimethyl 2-[(2E,6E)-8-[tert-butyl(dimethyl)silyl]oxy-3,7-dimethylundeca-2,6,10-trienyl]-2-[(E)-4,5-dimethylhex-3-enyl]propanedioate.
| Compound Name | dimethyl 2-[(2E,6E)-8-[tert-butyl(dimethyl)silyl]oxy-3,7-dimethylundeca-2,6,10-trienyl]-2-[(E)-4,5-dimethylhex-3-enyl]propanedioate |
|---|---|
| PubChem CID | 122233932 |
| Molecular Formula | C32H56O5Si |
| Molecular Weight | 548.88 g/mol |
| Exact Mass | 548.39 |
| IUPAC Name | dimethyl 2-[(2E,6E)-8-[tert-butyl(dimethyl)silyl]oxy-3,7-dimethylundeca-2,6,10-trienyl]-2-[(E)-4,5-dimethylhex-3-enyl]propanedioate |
| SMILES | C=CCC(O[Si](C)(C)C(C)(C)C)/C(C)=C/CC/C(C)=C/CC(CC/C=C(\C)C(C)C)(C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C32H56O5Si/c1-14-17-28(37-38(12,13)31(7,8)9)27(6)19-15-18-25(4)21-23-32(29(33)35-10,30(34)36-11)22-16-20-26(5)24(2)3/h14,19-21,24,28H,1,15-18,22-23H2,2-13H3/b25-21+,26-20+,27-19+ |
| InChIKey | KVCSDFSKVKZUTQ-RXWLTONBSA-N |
| XLogP | 8.73 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.88 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|