C33H58O5Si — CID 122233933
dimethyl 2-[(2E,6E)-8-[tert-butyl(dimethyl)silyl]oxy-3,7-dimethylundeca-2,6,10-trienyl]-2-[(E)-4,5,5-trimethylhex-3-enyl]propanedioate (PubChem CID 122233933) has the molecular formula C33H58O5Si and a molecular weight of 562.91 g/mol. Its IUPAC name is dimethyl 2-[(2E,6E)-8-[tert-butyl(dimethyl)silyl]oxy-3,7-dimethylundeca-2,6,10-trienyl]-2-[(E)-4,5,5-trimethylhex-3-enyl]propanedioate.
| Compound Name | dimethyl 2-[(2E,6E)-8-[tert-butyl(dimethyl)silyl]oxy-3,7-dimethylundeca-2,6,10-trienyl]-2-[(E)-4,5,5-trimethylhex-3-enyl]propanedioate |
|---|---|
| PubChem CID | 122233933 |
| Molecular Formula | C33H58O5Si |
| Molecular Weight | 562.91 g/mol |
| Exact Mass | 562.41 |
| IUPAC Name | dimethyl 2-[(2E,6E)-8-[tert-butyl(dimethyl)silyl]oxy-3,7-dimethylundeca-2,6,10-trienyl]-2-[(E)-4,5,5-trimethylhex-3-enyl]propanedioate |
| SMILES | C=CCC(O[Si](C)(C)C(C)(C)C)/C(C)=C/CC/C(C)=C/CC(CC/C=C(\C)C(C)(C)C)(C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C33H58O5Si/c1-15-18-28(38-39(13,14)32(8,9)10)26(3)20-16-19-25(2)22-24-33(29(34)36-11,30(35)37-12)23-17-21-27(4)31(5,6)7/h15,20-22,28H,1,16-19,23-24H2,2-14H3/b25-22+,26-20+,27-21+ |
| InChIKey | JXFJSXMWNMTNFP-UBACCCJVSA-N |
| XLogP | 9.12 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.91 |
| LogP ≤ 5 | 9.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|