C27H27FO5S — CID 122234226
4-[(Z)-1,3-bis(4-methoxyphenyl)-3-oxoprop-1-enyl]-2,3,5,6-tetramethylbenzenesulfonyl fluoride (PubChem CID 122234226) has the molecular formula C27H27FO5S and a molecular weight of 482.57 g/mol. Its IUPAC name is 4-[(Z)-1,3-bis(4-methoxyphenyl)-3-oxoprop-1-enyl]-2,3,5,6-tetramethylbenzenesulfonyl fluoride.
| Compound Name | 4-[(Z)-1,3-bis(4-methoxyphenyl)-3-oxoprop-1-enyl]-2,3,5,6-tetramethylbenzenesulfonyl fluoride |
|---|---|
| PubChem CID | 122234226 |
| Molecular Formula | C27H27FO5S |
| Molecular Weight | 482.57 g/mol |
| Exact Mass | 482.16 |
| IUPAC Name | 4-[(Z)-1,3-bis(4-methoxyphenyl)-3-oxoprop-1-enyl]-2,3,5,6-tetramethylbenzenesulfonyl fluoride |
| SMILES | COc1ccc(C(=O)/C=C(/c2ccc(OC)cc2)c2c(C)c(C)c(S(=O)(=O)F)c(C)c2C)cc1 |
| InChI | InChI=1S/C27H27FO5S/c1-16-18(3)27(34(28,30)31)19(4)17(2)26(16)24(20-7-11-22(32-5)12-8-20)15-25(29)21-9-13-23(33-6)14-10-21/h7-15H,1-6H3/b24-15- |
| InChIKey | KSSPYMGSDFRMPD-IWIPYMOSSA-N |
| XLogP | 5.91 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.57 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|