C23H21F3NO3P — CID 122234251
ethyl (2S)-2-(diphenylphosphorylamino)-2-[4-(trifluoromethyl)phenyl]acetate (PubChem CID 122234251) has the molecular formula C23H21F3NO3P and a molecular weight of 447.39 g/mol. Its IUPAC name is ethyl (2S)-2-(diphenylphosphorylamino)-2-[4-(trifluoromethyl)phenyl]acetate.
| Compound Name | ethyl (2S)-2-(diphenylphosphorylamino)-2-[4-(trifluoromethyl)phenyl]acetate |
|---|---|
| PubChem CID | 122234251 |
| Molecular Formula | C23H21F3NO3P |
| Molecular Weight | 447.39 g/mol |
| Exact Mass | 447.12 |
| IUPAC Name | ethyl (2S)-2-(diphenylphosphorylamino)-2-[4-(trifluoromethyl)phenyl]acetate |
| SMILES | CCOC(=O)[C@@H](NP(=O)(c1ccccc1)c1ccccc1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C23H21F3NO3P/c1-2-30-22(28)21(17-13-15-18(16-14-17)23(24,25)26)27-31(29,19-9-5-3-6-10-19)20-11-7-4-8-12-20/h3-16,21H,2H2,1H3,(H,27,29)/t21-/m0/s1 |
| InChIKey | UYIJOJJORWSAGG-NRFANRHFSA-N |
| XLogP | 4.83 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.39 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|