C22H20Cl2N2O4S — CID 122234403
2-[2,3-dichloro-4-(2-methylidenebutanoyl)phenoxy]-N-[(3S)-4-oxo-3,5-dihydro-2H-1,5-benzothiazepin-3-yl]acetamide (PubChem CID 122234403) has the molecular formula C22H20Cl2N2O4S and a molecular weight of 479.39 g/mol. Its IUPAC name is 2-[2,3-dichloro-4-(2-methylidenebutanoyl)phenoxy]-N-[(3S)-4-oxo-3,5-dihydro-2H-1,5-benzothiazepin-3-yl]acetamide.
| Compound Name | 2-[2,3-dichloro-4-(2-methylidenebutanoyl)phenoxy]-N-[(3S)-4-oxo-3,5-dihydro-2H-1,5-benzothiazepin-3-yl]acetamide |
|---|---|
| PubChem CID | 122234403 |
| Molecular Formula | C22H20Cl2N2O4S |
| Molecular Weight | 479.39 g/mol |
| Exact Mass | 478.05 |
| IUPAC Name | 2-[2,3-dichloro-4-(2-methylidenebutanoyl)phenoxy]-N-[(3S)-4-oxo-3,5-dihydro-2H-1,5-benzothiazepin-3-yl]acetamide |
| SMILES | C=C(CC)C(=O)c1ccc(OCC(=O)N[C@@H]2CSc3ccccc3NC2=O)c(Cl)c1Cl |
| InChI | InChI=1S/C22H20Cl2N2O4S/c1-3-12(2)21(28)13-8-9-16(20(24)19(13)23)30-10-18(27)25-15-11-31-17-7-5-4-6-14(17)26-22(15)29/h4-9,15H,2-3,10-11H2,1H3,(H,25,27)(H,26,29)/t15-/m1/s1 |
| InChIKey | NNMMTUBCPRTTIN-OAHLLOKOSA-N |
| XLogP | 4.75 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.39 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|