About 1-adamantyl 7-(1,3-dioxoisoindol-2-yl)-2-methylhepta-2,3-dienoate
1-adamantyl 7-(1,3-dioxoisoindol-2-yl)-2-methylhepta-2,3-dienoate (PubChem CID 122234669) has the molecular formula C26H29NO4
and a molecular weight of 419.52 g/mol. Its IUPAC name is 1-adamantyl 7-(1,3-dioxoisoindol-2-yl)-2-methylhepta-2,3-dienoate.
Molecular Properties
| Compound Name | 1-adamantyl 7-(1,3-dioxoisoindol-2-yl)-2-methylhepta-2,3-dienoate |
| PubChem CID | 122234669 |
| Molecular Formula | C26H29NO4 |
| Molecular Weight | 419.52 g/mol |
| Exact Mass | 419.21 |
| IUPAC Name | 1-adamantyl 7-(1,3-dioxoisoindol-2-yl)-2-methylhepta-2,3-dienoate |
| SMILES | CC(=C=CCCCN1C(=O)c2ccccc2C1=O)C(=O)OC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C26H29NO4/c1-17(25(30)31-26-14-18-11-19(15-26)13-20(12-18)16-26)7-3-2-6-10-27-23(28)21-8-4-5-9-22(21)24(27)29/h3-5,8-9,18-20H,2,6,10-16H2,1H3 |
| InChIKey | DHUNNKNZETUHMA-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 419.52 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 1-adamantyl 7-(1,3-dioxoisoindol-2-yl)-2-methylhepta-2,3-dienoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-adamantyl 7-(1,3-dioxoisoindol-2-yl)-2-methylhepta-2,3-dienoate?
The IUPAC name of 1-adamantyl 7-(1,3-dioxoisoindol-2-yl)-2-methylhepta-2,3-dienoate (CID 122234669) is 1-adamantyl 7-(1,3-dioxoisoindol-2-yl)-2-methylhepta-2,3-dienoate.
What is the SMILES notation for 1-adamantyl 7-(1,3-dioxoisoindol-2-yl)-2-methylhepta-2,3-dienoate?
The canonical SMILES for 1-adamantyl 7-(1,3-dioxoisoindol-2-yl)-2-methylhepta-2,3-dienoate is CC(=C=CCCCN1C(=O)c2ccccc2C1=O)C(=O)OC12CC3CC(CC(C3)C1)C2.
What is the InChIKey of 1-adamantyl 7-(1,3-dioxoisoindol-2-yl)-2-methylhepta-2,3-dienoate?
The InChIKey is DHUNNKNZETUHMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H29NO4/c1-17(25(30)31-26-14-18-11-19(15-26)13-20(12-18)16-26)7-3-2-6-10-27-23(28)21-8-4-5-9-22(21)24(27)29/h3-5,8-9,18-20H,2,6,10-16H2,1H3.
What are the key properties of 1-adamantyl 7-(1,3-dioxoisoindol-2-yl)-2-methylhepta-2,3-dienoate?
1-adamantyl 7-(1,3-dioxoisoindol-2-yl)-2-methylhepta-2,3-dienoate has a molecular weight of 419.52 g/mol, XLogP of 4.68, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-adamantyl 7-(1,3-dioxoisoindol-2-yl)-2-methylhepta-2,3-dienoate is sourced from PubChem (CID 122234669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).