C9H20Cl2N2O — CID 122235803
(3S,4S)-4-piperidin-1-yloxolan-3-amine;dihydrochloride (PubChem CID 122235803) has the molecular formula C9H20Cl2N2O and a molecular weight of 243.18 g/mol. Its IUPAC name is (3S,4S)-4-piperidin-1-yloxolan-3-amine;dihydrochloride.
| Compound Name | (3S,4S)-4-piperidin-1-yloxolan-3-amine;dihydrochloride |
|---|---|
| PubChem CID | 122235803 |
| Molecular Formula | C9H20Cl2N2O |
| Molecular Weight | 243.18 g/mol |
| Exact Mass | 242.10 |
| IUPAC Name | (3S,4S)-4-piperidin-1-yloxolan-3-amine;dihydrochloride |
| SMILES | Cl.Cl.N[C@@H]1COC[C@H]1N1CCCCC1 |
| InChI | InChI=1S/C9H18N2O.2ClH/c10-8-6-12-7-9(8)11-4-2-1-3-5-11;;/h8-9H,1-7,10H2;2*1H/t8-,9-;;/m1../s1 |
| InChIKey | MAIIJKAMBNKIRT-UONRGADFSA-N |
| XLogP | 1.04 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.18 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |