C9H19ClN2O4 — CID 122235943
(2S)-2-[[(2S)-2-amino-4-methylpentanoyl]amino]-3-hydroxypropanoic acid;hydrochloride (PubChem CID 122235943) has the molecular formula C9H19ClN2O4 and a molecular weight of 254.71 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-amino-4-methylpentanoyl]amino]-3-hydroxypropanoic acid;hydrochloride.
| Compound Name | (2S)-2-[[(2S)-2-amino-4-methylpentanoyl]amino]-3-hydroxypropanoic acid;hydrochloride |
|---|---|
| PubChem CID | 122235943 |
| Molecular Formula | C9H19ClN2O4 |
| Molecular Weight | 254.71 g/mol |
| Exact Mass | 254.10 |
| IUPAC Name | (2S)-2-[[(2S)-2-amino-4-methylpentanoyl]amino]-3-hydroxypropanoic acid;hydrochloride |
| SMILES | CC(C)C[C@H](N)C(=O)N[C@@H](CO)C(=O)O.Cl |
| InChI | InChI=1S/C9H18N2O4.ClH/c1-5(2)3-6(10)8(13)11-7(4-12)9(14)15;/h5-7,12H,3-4,10H2,1-2H3,(H,11,13)(H,14,15);1H/t6-,7-;/m0./s1 |
| InChIKey | NJMUBTVHCBSODQ-LEUCUCNGSA-N |
| XLogP | -0.66 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.71 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |