About 2-ethenyloxolan-3-amine
2-ethenyloxolan-3-amine (PubChem CID 122236250) has the molecular formula C6H11NO
and a molecular weight of 113.16 g/mol. Its IUPAC name is 2-ethenyloxolan-3-amine.
Molecular Properties
| Compound Name | 2-ethenyloxolan-3-amine |
| PubChem CID | 122236250 |
| Molecular Formula | C6H11NO |
| Molecular Weight | 113.16 g/mol |
| Exact Mass | 113.08 |
| IUPAC Name | 2-ethenyloxolan-3-amine |
| SMILES | C=CC1OCCC1N |
| InChI | InChI=1S/C6H11NO/c1-2-6-5(7)3-4-8-6/h2,5-6H,1,3-4,7H2 |
| InChIKey | MNJYWTHQNUBTIC-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 113.16 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-ethenyloxolan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethenyloxolan-3-amine?
The IUPAC name of 2-ethenyloxolan-3-amine (CID 122236250) is 2-ethenyloxolan-3-amine.
What is the SMILES notation for 2-ethenyloxolan-3-amine?
The canonical SMILES for 2-ethenyloxolan-3-amine is C=CC1OCCC1N.
What is the InChIKey of 2-ethenyloxolan-3-amine?
The InChIKey is MNJYWTHQNUBTIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO/c1-2-6-5(7)3-4-8-6/h2,5-6H,1,3-4,7H2.
What are the key properties of 2-ethenyloxolan-3-amine?
2-ethenyloxolan-3-amine has a molecular weight of 113.16 g/mol, XLogP of 0.29, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethenyloxolan-3-amine is sourced from PubChem (CID 122236250), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).