About (2R,3S)-2-ethenyloxolan-3-amine;hydrochloride
(2R,3S)-2-ethenyloxolan-3-amine;hydrochloride (PubChem CID 122236300) has the molecular formula C6H12ClNO
and a molecular weight of 149.62 g/mol. Its IUPAC name is (2R,3S)-2-ethenyloxolan-3-amine;hydrochloride.
Molecular Properties
| Compound Name | (2R,3S)-2-ethenyloxolan-3-amine;hydrochloride |
| PubChem CID | 122236300 |
| Molecular Formula | C6H12ClNO |
| Molecular Weight | 149.62 g/mol |
| Exact Mass | 149.06 |
| IUPAC Name | (2R,3S)-2-ethenyloxolan-3-amine;hydrochloride |
| SMILES | C=C[C@H]1OCC[C@@H]1N.Cl |
| InChI | InChI=1S/C6H11NO.ClH/c1-2-6-5(7)3-4-8-6;/h2,5-6H,1,3-4,7H2;1H/t5-,6+;/m0./s1 |
| InChIKey | BWAQJMHAMWXPKL-RIHPBJNCSA-N |
| XLogP | 0.71 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.62 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2R,3S)-2-ethenyloxolan-3-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,3S)-2-ethenyloxolan-3-amine;hydrochloride?
The IUPAC name of (2R,3S)-2-ethenyloxolan-3-amine;hydrochloride (CID 122236300) is (2R,3S)-2-ethenyloxolan-3-amine;hydrochloride.
What is the SMILES notation for (2R,3S)-2-ethenyloxolan-3-amine;hydrochloride?
The canonical SMILES for (2R,3S)-2-ethenyloxolan-3-amine;hydrochloride is C=C[C@H]1OCC[C@@H]1N.Cl.
What is the InChIKey of (2R,3S)-2-ethenyloxolan-3-amine;hydrochloride?
The InChIKey is BWAQJMHAMWXPKL-RIHPBJNCSA-N. The full InChI is InChI=1S/C6H11NO.ClH/c1-2-6-5(7)3-4-8-6;/h2,5-6H,1,3-4,7H2;1H/t5-,6+;/m0./s1.
What are the key properties of (2R,3S)-2-ethenyloxolan-3-amine;hydrochloride?
(2R,3S)-2-ethenyloxolan-3-amine;hydrochloride has a molecular weight of 149.62 g/mol, XLogP of 0.71, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,3S)-2-ethenyloxolan-3-amine;hydrochloride is sourced from PubChem (CID 122236300), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).