C4H8F3NO — CID 122236482
(2R,3R)-3-amino-4,4,4-trifluorobutan-2-ol (PubChem CID 122236482) has the molecular formula C4H8F3NO and a molecular weight of 143.11 g/mol. Its IUPAC name is (2R,3R)-3-amino-4,4,4-trifluorobutan-2-ol.
| Compound Name | (2R,3R)-3-amino-4,4,4-trifluorobutan-2-ol |
|---|---|
| PubChem CID | 122236482 |
| Molecular Formula | C4H8F3NO |
| Molecular Weight | 143.11 g/mol |
| Exact Mass | 143.06 |
| IUPAC Name | (2R,3R)-3-amino-4,4,4-trifluorobutan-2-ol |
| SMILES | C[C@@H](O)[C@@H](N)C(F)(F)F |
| InChI | InChI=1S/C4H8F3NO/c1-2(9)3(8)4(5,6)7/h2-3,9H,8H2,1H3/t2-,3-/m1/s1 |
| InChIKey | MAINWOGXJHYRLE-PWNYCUMCSA-N |
| XLogP | 0.26 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.11 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |