C9H17NO3 — CID 122236870
(3S,4R)-4-[[(1R,2R)-2-hydroxycyclopentyl]amino]oxolan-3-ol (PubChem CID 122236870) has the molecular formula C9H17NO3 and a molecular weight of 187.24 g/mol. Its IUPAC name is (3S,4R)-4-[[(1R,2R)-2-hydroxycyclopentyl]amino]oxolan-3-ol.
| Compound Name | (3S,4R)-4-[[(1R,2R)-2-hydroxycyclopentyl]amino]oxolan-3-ol |
|---|---|
| PubChem CID | 122236870 |
| Molecular Formula | C9H17NO3 |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.12 |
| IUPAC Name | (3S,4R)-4-[[(1R,2R)-2-hydroxycyclopentyl]amino]oxolan-3-ol |
| SMILES | O[C@@H]1CCC[C@H]1N[C@@H]1COC[C@H]1O |
| InChI | InChI=1S/C9H17NO3/c11-8-3-1-2-6(8)10-7-4-13-5-9(7)12/h6-12H,1-5H2/t6-,7-,8-,9-/m1/s1 |
| InChIKey | ZFTOUQCYFOUPCX-FNCVBFRFSA-N |
| XLogP | -0.75 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |