C6H3Br3 — CID 122236902
1,3,5-tribromo-2,4,6-trideuteriobenzene (PubChem CID 122236902) has the molecular formula C6H3Br3 and a molecular weight of 317.82 g/mol. Its IUPAC name is 1,3,5-tribromo-2,4,6-trideuteriobenzene.
| Compound Name | 1,3,5-tribromo-2,4,6-trideuteriobenzene |
|---|---|
| PubChem CID | 122236902 |
| Molecular Formula | C6H3Br3 |
| Molecular Weight | 317.82 g/mol |
| Exact Mass | 314.80 |
| IUPAC Name | 1,3,5-tribromo-2,4,6-trideuteriobenzene |
| SMILES | [2H]c1c(Br)c([2H])c(Br)c([2H])c1Br |
| InChI | InChI=1S/C6H3Br3/c7-4-1-5(8)3-6(9)2-4/h1-3H/i1D,2D,3D |
| InChIKey | YWDUZLFWHVQCHY-CBYSEHNBSA-N |
| XLogP | 3.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.82 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |