C10H20N2O2 — CID 122236959
(3R,4R)-4-[methyl(oxolan-3-ylmethyl)amino]pyrrolidin-3-ol (PubChem CID 122236959) has the molecular formula C10H20N2O2 and a molecular weight of 200.28 g/mol. Its IUPAC name is (3R,4R)-4-[methyl(oxolan-3-ylmethyl)amino]pyrrolidin-3-ol.
| Compound Name | (3R,4R)-4-[methyl(oxolan-3-ylmethyl)amino]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 122236959 |
| Molecular Formula | C10H20N2O2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.15 |
| IUPAC Name | (3R,4R)-4-[methyl(oxolan-3-ylmethyl)amino]pyrrolidin-3-ol |
| SMILES | CN(CC1CCOC1)[C@@H]1CNC[C@H]1O |
| InChI | InChI=1S/C10H20N2O2/c1-12(6-8-2-3-14-7-8)9-4-11-5-10(9)13/h8-11,13H,2-7H2,1H3/t8?,9-,10-/m1/s1 |
| InChIKey | QNALMLQHNHYKQP-VXRWAFEHSA-N |
| XLogP | -0.71 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |