About 6-bromo-8-fluoro-1,3-benzodioxin-4-one
6-bromo-8-fluoro-1,3-benzodioxin-4-one (PubChem CID 122237026) has the molecular formula C8H4BrFO3
and a molecular weight of 247.02 g/mol. Its IUPAC name is 6-bromo-8-fluoro-1,3-benzodioxin-4-one.
Molecular Properties
| Compound Name | 6-bromo-8-fluoro-1,3-benzodioxin-4-one |
| PubChem CID | 122237026 |
| Molecular Formula | C8H4BrFO3 |
| Molecular Weight | 247.02 g/mol |
| Exact Mass | 245.93 |
| IUPAC Name | 6-bromo-8-fluoro-1,3-benzodioxin-4-one |
| SMILES | O=C1OCOc2c(F)cc(Br)cc21 |
| InChI | InChI=1S/C8H4BrFO3/c9-4-1-5-7(6(10)2-4)12-3-13-8(5)11/h1-2H,3H2 |
| InChIKey | IQUXKDVUCWBBCB-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.02 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-bromo-8-fluoro-1,3-benzodioxin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-8-fluoro-1,3-benzodioxin-4-one?
The IUPAC name of 6-bromo-8-fluoro-1,3-benzodioxin-4-one (CID 122237026) is 6-bromo-8-fluoro-1,3-benzodioxin-4-one.
What is the SMILES notation for 6-bromo-8-fluoro-1,3-benzodioxin-4-one?
The canonical SMILES for 6-bromo-8-fluoro-1,3-benzodioxin-4-one is O=C1OCOc2c(F)cc(Br)cc21.
What is the InChIKey of 6-bromo-8-fluoro-1,3-benzodioxin-4-one?
The InChIKey is IQUXKDVUCWBBCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4BrFO3/c9-4-1-5-7(6(10)2-4)12-3-13-8(5)11/h1-2H,3H2.
What are the key properties of 6-bromo-8-fluoro-1,3-benzodioxin-4-one?
6-bromo-8-fluoro-1,3-benzodioxin-4-one has a molecular weight of 247.02 g/mol, XLogP of 2.09, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-8-fluoro-1,3-benzodioxin-4-one is sourced from PubChem (CID 122237026), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).