About trans-(1R,2R)-2-(3,6-dihydro-2H-pyran-5-ylmethylamino)cyclopentan-1-ol
trans-(1R,2R)-2-(3,6-dihydro-2H-pyran-5-ylmethylamino)cyclopentan-1-ol (PubChem CID 122237287) has the molecular formula C11H19NO2
and a molecular weight of 197.28 g/mol. Its IUPAC name is trans-(1R,2R)-2-(3,6-dihydro-2H-pyran-5-ylmethylamino)cyclopentan-1-ol.
Molecular Properties
| Compound Name | trans-(1R,2R)-2-(3,6-dihydro-2H-pyran-5-ylmethylamino)cyclopentan-1-ol |
| PubChem CID | 122237287 |
| Molecular Formula | C11H19NO2 |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.14 |
| IUPAC Name | trans-(1R,2R)-2-(3,6-dihydro-2H-pyran-5-ylmethylamino)cyclopentan-1-ol |
| SMILES | O[C@@H]1CCC[C@H]1NCC1=CCCOC1 |
| InChI | InChI=1S/C11H19NO2/c13-11-5-1-4-10(11)12-7-9-3-2-6-14-8-9/h3,10-13H,1-2,4-8H2/t10-,11-/m1/s1 |
| InChIKey | YRLFWHINDBAVAU-GHMZBOCLSA-N |
| XLogP | 0.84 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze trans-(1R,2R)-2-(3,6-dihydro-2H-pyran-5-ylmethylamino)cyclopentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(1R,2R)-2-(3,6-dihydro-2H-pyran-5-ylmethylamino)cyclopentan-1-ol?
The IUPAC name of trans-(1R,2R)-2-(3,6-dihydro-2H-pyran-5-ylmethylamino)cyclopentan-1-ol (CID 122237287) is trans-(1R,2R)-2-(3,6-dihydro-2H-pyran-5-ylmethylamino)cyclopentan-1-ol.
What is the SMILES notation for trans-(1R,2R)-2-(3,6-dihydro-2H-pyran-5-ylmethylamino)cyclopentan-1-ol?
The canonical SMILES for trans-(1R,2R)-2-(3,6-dihydro-2H-pyran-5-ylmethylamino)cyclopentan-1-ol is O[C@@H]1CCC[C@H]1NCC1=CCCOC1.
What is the InChIKey of trans-(1R,2R)-2-(3,6-dihydro-2H-pyran-5-ylmethylamino)cyclopentan-1-ol?
The InChIKey is YRLFWHINDBAVAU-GHMZBOCLSA-N. The full InChI is InChI=1S/C11H19NO2/c13-11-5-1-4-10(11)12-7-9-3-2-6-14-8-9/h3,10-13H,1-2,4-8H2/t10-,11-/m1/s1.
What are the key properties of trans-(1R,2R)-2-(3,6-dihydro-2H-pyran-5-ylmethylamino)cyclopentan-1-ol?
trans-(1R,2R)-2-(3,6-dihydro-2H-pyran-5-ylmethylamino)cyclopentan-1-ol has a molecular weight of 197.28 g/mol, XLogP of 0.84, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(1R,2R)-2-(3,6-dihydro-2H-pyran-5-ylmethylamino)cyclopentan-1-ol is sourced from PubChem (CID 122237287), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).