C16H20F3NO3S — CID 122237839
tert-butyl 3-[[4-(trifluoromethylsulfanyl)phenyl]methoxy]azetidine-1-carboxylate (PubChem CID 122237839) has the molecular formula C16H20F3NO3S and a molecular weight of 363.40 g/mol. Its IUPAC name is tert-butyl 3-[[4-(trifluoromethylsulfanyl)phenyl]methoxy]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[[4-(trifluoromethylsulfanyl)phenyl]methoxy]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 122237839 |
| Molecular Formula | C16H20F3NO3S |
| Molecular Weight | 363.40 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | tert-butyl 3-[[4-(trifluoromethylsulfanyl)phenyl]methoxy]azetidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(OCc2ccc(SC(F)(F)F)cc2)C1 |
| InChI | InChI=1S/C16H20F3NO3S/c1-15(2,3)23-14(21)20-8-12(9-20)22-10-11-4-6-13(7-5-11)24-16(17,18)19/h4-7,12H,8-10H2,1-3H3 |
| InChIKey | UOCJXGFRIPOPSD-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.40 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |