C26H24ClF2NO7S2 — CID 122238737
5-[2-[(4S,10bS)-10b-(4-chlorophenyl)sulfonyl-7,10-difluoro-2,4,4a,5-tetrahydro-1H-pyrano[3,4-c]chromen-4-yl]ethylsulfonyl]-2-methoxypyridine (PubChem CID 122238737) has the molecular formula C26H24ClF2NO7S2 and a molecular weight of 600.06 g/mol. Its IUPAC name is 5-[2-[(4S,10bS)-10b-(4-chlorophenyl)sulfonyl-7,10-difluoro-2,4,4a,5-tetrahydro-1H-pyrano[3,4-c]chromen-4-yl]ethylsulfonyl]-2-methoxypyridine.
| Compound Name | 5-[2-[(4S,10bS)-10b-(4-chlorophenyl)sulfonyl-7,10-difluoro-2,4,4a,5-tetrahydro-1H-pyrano[3,4-c]chromen-4-yl]ethylsulfonyl]-2-methoxypyridine |
|---|---|
| PubChem CID | 122238737 |
| Molecular Formula | C26H24ClF2NO7S2 |
| Molecular Weight | 600.06 g/mol |
| Exact Mass | 599.07 |
| IUPAC Name | 5-[2-[(4S,10bS)-10b-(4-chlorophenyl)sulfonyl-7,10-difluoro-2,4,4a,5-tetrahydro-1H-pyrano[3,4-c]chromen-4-yl]ethylsulfonyl]-2-methoxypyridine |
| SMILES | COc1ccc(S(=O)(=O)CC[C@@H]2OCC[C@@]3(S(=O)(=O)c4ccc(Cl)cc4)c4c(F)ccc(F)c4OCC23)cn1 |
| InChI | InChI=1S/C26H24ClF2NO7S2/c1-35-23-9-6-18(14-30-23)38(31,32)13-10-22-19-15-37-25-21(29)8-7-20(28)24(25)26(19,11-12-36-22)39(33,34)17-4-2-16(27)3-5-17/h2-9,14,19,22H,10-13,15H2,1H3/t19?,22-,26-/m0/s1 |
| InChIKey | UYILXESMUHERMW-OKMMRDQBSA-N |
| XLogP | 4.35 |
| TPSA | 108.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.06 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |