C12H11FN2O2 — CID 122239134
3-ethyl-6-(4-fluorophenyl)-1H-pyrimidine-2,4-dione (PubChem CID 122239134) has the molecular formula C12H11FN2O2 and a molecular weight of 234.23 g/mol. Its IUPAC name is 3-ethyl-6-(4-fluorophenyl)-1H-pyrimidine-2,4-dione.
| Compound Name | 3-ethyl-6-(4-fluorophenyl)-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 122239134 |
| Molecular Formula | C12H11FN2O2 |
| Molecular Weight | 234.23 g/mol |
| Exact Mass | 234.08 |
| IUPAC Name | 3-ethyl-6-(4-fluorophenyl)-1H-pyrimidine-2,4-dione |
| SMILES | CCn1c(=O)cc(-c2ccc(F)cc2)[nH]c1=O |
| InChI | InChI=1S/C12H11FN2O2/c1-2-15-11(16)7-10(14-12(15)17)8-3-5-9(13)6-4-8/h3-7H,2H2,1H3,(H,14,17) |
| InChIKey | VMTLAPFXVVSHML-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.23 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |