About 2-fluoro-N,4-dimethylpentan-1-amine;hydrochloride
2-fluoro-N,4-dimethylpentan-1-amine;hydrochloride (PubChem CID 122239516) has the molecular formula C7H17ClFN
and a molecular weight of 169.67 g/mol. Its IUPAC name is 2-fluoro-N,4-dimethylpentan-1-amine;hydrochloride.
Molecular Properties
| Compound Name | 2-fluoro-N,4-dimethylpentan-1-amine;hydrochloride |
| PubChem CID | 122239516 |
| Molecular Formula | C7H17ClFN |
| Molecular Weight | 169.67 g/mol |
| Exact Mass | 169.10 |
| IUPAC Name | 2-fluoro-N,4-dimethylpentan-1-amine;hydrochloride |
| SMILES | CNCC(F)CC(C)C.Cl |
| InChI | InChI=1S/C7H16FN.ClH/c1-6(2)4-7(8)5-9-3;/h6-7,9H,4-5H2,1-3H3;1H |
| InChIKey | OKCYPEFTOGKKMG-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.67 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-fluoro-N,4-dimethylpentan-1-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-N,4-dimethylpentan-1-amine;hydrochloride?
The IUPAC name of 2-fluoro-N,4-dimethylpentan-1-amine;hydrochloride (CID 122239516) is 2-fluoro-N,4-dimethylpentan-1-amine;hydrochloride.
What is the SMILES notation for 2-fluoro-N,4-dimethylpentan-1-amine;hydrochloride?
The canonical SMILES for 2-fluoro-N,4-dimethylpentan-1-amine;hydrochloride is CNCC(F)CC(C)C.Cl.
What is the InChIKey of 2-fluoro-N,4-dimethylpentan-1-amine;hydrochloride?
The InChIKey is OKCYPEFTOGKKMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16FN.ClH/c1-6(2)4-7(8)5-9-3;/h6-7,9H,4-5H2,1-3H3;1H.
What are the key properties of 2-fluoro-N,4-dimethylpentan-1-amine;hydrochloride?
2-fluoro-N,4-dimethylpentan-1-amine;hydrochloride has a molecular weight of 169.67 g/mol, XLogP of 2.01, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-N,4-dimethylpentan-1-amine;hydrochloride is sourced from PubChem (CID 122239516), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).