C10H8ClFO4 — CID 122239702
2-[(2-chlorophenyl)methyl]-2-fluoropropanedioic acid (PubChem CID 122239702) has the molecular formula C10H8ClFO4 and a molecular weight of 246.62 g/mol. Its IUPAC name is 2-[(2-chlorophenyl)methyl]-2-fluoropropanedioic acid.
| Compound Name | 2-[(2-chlorophenyl)methyl]-2-fluoropropanedioic acid |
|---|---|
| PubChem CID | 122239702 |
| Molecular Formula | C10H8ClFO4 |
| Molecular Weight | 246.62 g/mol |
| Exact Mass | 246.01 |
| IUPAC Name | 2-[(2-chlorophenyl)methyl]-2-fluoropropanedioic acid |
| SMILES | O=C(O)C(F)(Cc1ccccc1Cl)C(=O)O |
| InChI | InChI=1S/C10H8ClFO4/c11-7-4-2-1-3-6(7)5-10(12,8(13)14)9(15)16/h1-4H,5H2,(H,13,14)(H,15,16) |
| InChIKey | IWKKQLSEAYVGGC-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.62 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|