About 2-fluoro-N,5-dimethylhex-4-en-1-amine
2-fluoro-N,5-dimethylhex-4-en-1-amine (PubChem CID 122239915) has the molecular formula C8H16FN
and a molecular weight of 145.22 g/mol. Its IUPAC name is 2-fluoro-N,5-dimethylhex-4-en-1-amine.
Molecular Properties
| Compound Name | 2-fluoro-N,5-dimethylhex-4-en-1-amine |
| PubChem CID | 122239915 |
| Molecular Formula | C8H16FN |
| Molecular Weight | 145.22 g/mol |
| Exact Mass | 145.13 |
| IUPAC Name | 2-fluoro-N,5-dimethylhex-4-en-1-amine |
| SMILES | CNCC(F)CC=C(C)C |
| InChI | InChI=1S/C8H16FN/c1-7(2)4-5-8(9)6-10-3/h4,8,10H,5-6H2,1-3H3 |
| InChIKey | MKMMGWMWEXSHNY-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.22 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoro-N,5-dimethylhex-4-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-N,5-dimethylhex-4-en-1-amine?
The IUPAC name of 2-fluoro-N,5-dimethylhex-4-en-1-amine (CID 122239915) is 2-fluoro-N,5-dimethylhex-4-en-1-amine.
What is the SMILES notation for 2-fluoro-N,5-dimethylhex-4-en-1-amine?
The canonical SMILES for 2-fluoro-N,5-dimethylhex-4-en-1-amine is CNCC(F)CC=C(C)C.
What is the InChIKey of 2-fluoro-N,5-dimethylhex-4-en-1-amine?
The InChIKey is MKMMGWMWEXSHNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16FN/c1-7(2)4-5-8(9)6-10-3/h4,8,10H,5-6H2,1-3H3.
What are the key properties of 2-fluoro-N,5-dimethylhex-4-en-1-amine?
2-fluoro-N,5-dimethylhex-4-en-1-amine has a molecular weight of 145.22 g/mol, XLogP of 1.90, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-N,5-dimethylhex-4-en-1-amine is sourced from PubChem (CID 122239915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).