About 2,2-dimethyl-3-naphthalen-2-ylpropan-1-amine;hydrochloride
2,2-dimethyl-3-naphthalen-2-ylpropan-1-amine;hydrochloride (PubChem CID 122240080) has the molecular formula C15H20ClN
and a molecular weight of 249.79 g/mol. Its IUPAC name is 2,2-dimethyl-3-naphthalen-2-ylpropan-1-amine;hydrochloride.
Molecular Properties
| Compound Name | 2,2-dimethyl-3-naphthalen-2-ylpropan-1-amine;hydrochloride |
| PubChem CID | 122240080 |
| Molecular Formula | C15H20ClN |
| Molecular Weight | 249.79 g/mol |
| Exact Mass | 249.13 |
| IUPAC Name | 2,2-dimethyl-3-naphthalen-2-ylpropan-1-amine;hydrochloride |
| SMILES | CC(C)(CN)Cc1ccc2ccccc2c1.Cl |
| InChI | InChI=1S/C15H19N.ClH/c1-15(2,11-16)10-12-7-8-13-5-3-4-6-14(13)9-12;/h3-9H,10-11,16H2,1-2H3;1H |
| InChIKey | NARBPBMGPMMEII-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.79 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,2-dimethyl-3-naphthalen-2-ylpropan-1-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethyl-3-naphthalen-2-ylpropan-1-amine;hydrochloride?
The IUPAC name of 2,2-dimethyl-3-naphthalen-2-ylpropan-1-amine;hydrochloride (CID 122240080) is 2,2-dimethyl-3-naphthalen-2-ylpropan-1-amine;hydrochloride.
What is the SMILES notation for 2,2-dimethyl-3-naphthalen-2-ylpropan-1-amine;hydrochloride?
The canonical SMILES for 2,2-dimethyl-3-naphthalen-2-ylpropan-1-amine;hydrochloride is CC(C)(CN)Cc1ccc2ccccc2c1.Cl.
What is the InChIKey of 2,2-dimethyl-3-naphthalen-2-ylpropan-1-amine;hydrochloride?
The InChIKey is NARBPBMGPMMEII-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19N.ClH/c1-15(2,11-16)10-12-7-8-13-5-3-4-6-14(13)9-12;/h3-9H,10-11,16H2,1-2H3;1H.
What are the key properties of 2,2-dimethyl-3-naphthalen-2-ylpropan-1-amine;hydrochloride?
2,2-dimethyl-3-naphthalen-2-ylpropan-1-amine;hydrochloride has a molecular weight of 249.79 g/mol, XLogP of 3.79, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethyl-3-naphthalen-2-ylpropan-1-amine;hydrochloride is sourced from PubChem (CID 122240080), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).